1 files changed, 222 insertions, 0 deletions
diff --git a/Wrapper/FreeImage.NET/cs/Samples/Sample 08 - Creating a plugin/SerializationPlugin.cs b/Wrapper/FreeImage.NET/cs/Samples/Sample 08 - Creating a plugin/SerializationPlugin.cs
new file mode 100644
index 0000000..a8ef7d5
--- /dev/null
+++ b/Wrapper/FreeImage.NET/cs/Samples/Sample 08 - Creating a plugin/SerializationPlugin.cs
@@ -0,0 +1,222 @@
+using System;
+using System.Collections.Generic;
+using System.Text;
+using System.Runtime.InteropServices;
+using System.Runtime.Serialization.Formatters.Binary;
+using System.IO;
+using System.IO.Compression;
+using FreeImageAPI;
+using FreeImageAPI.IO;
+using FreeImageAPI.Plugins;
+
+namespace Sample08
+{
+	public sealed class SerializationPlugin : LocalPlugin
+	{
+		// Header for the file
+		private byte[] header = new byte[] { 0xff, 0x12, 0x0f, 0xff, 0x01, 0x00 };
+
+		// Structure that will store all bitmap data.
+		[Serializable]
+		private struct SerialDib
+		{
+			public uint width;
+			public uint height;
+			public int pitch;
+			public uint bpp;
+			public uint red_mask;
+			public uint green_mask;
+			public uint blue_mask;
+			public byte[] data;
+		}
+
+		// Implementation of 'GetImplementedMethods()'
+		// All implemented methods are listed.
+		protected override LocalPlugin.MethodFlags GetImplementedMethods()
+		{
+			return
+				MethodFlags.DescriptionProc |
+				MethodFlags.SupportsExportBPPProc |
+				MethodFlags.SupportsExportTypeProc |
+				MethodFlags.SupportsICCProfilesProc |
+				MethodFlags.LoadProc |
+				MethodFlags.SaveProc |
+				MethodFlags.ValidateProc |
+				MethodFlags.ExtensionListProc;
+		}
+
+		// Returns a format string.
+		protected override string FormatProc()
+		{
+			return "Serialization";
+		}
+
+		// Returns a more specific description
+		protected override string DescriptionProc()
+		{
+			return "Serializes bitmaps for .NET";
+		}
+
+		// Returns whether a color depth is supported.
+		protected override bool SupportsExportBPPProc(int bpp)
+		{
+			return ((bpp == 1) ||
+					(bpp == 4) ||
+					(bpp == 8) ||
+					(bpp == 16) ||
+					(bpp == 24) ||
+					(bpp == 32));
+		}
+
+		// This plugin can only export standard bitmaps
+		protected override bool SupportsExportTypeProc(FREE_IMAGE_TYPE type)
+		{
+			return (type == FREE_IMAGE_TYPE.FIT_BITMAP);
+		}
+
+		// This plugin does not support icc profiles
+		protected override bool SupportsICCProfilesProc()
+		{
+			return false;
+		}
+
+		// The function reads the first bytes of the file and compares it
+		// with the predefined header.
+		protected override bool ValidateProc(ref FreeImageIO io, fi_handle handle)
+		{
+			for (int i = 0; i < header.Length; i++)
+				if (ReadByte(io, handle) != header[i])
+					return false;
+			return true;
+		}
+
+		// Loading function
+		protected override FIBITMAP LoadProc(ref FreeImageIO io, fi_handle handle, int page, int flags, IntPtr data)
+		{
+			// Check if the data has the correct format
+			if (!ValidateProc(ref io, handle))
+			{
+				// Create a free-image message
+				FreeImage.OutputMessageProc(format, "Invalid format.");
+				// return 0 (operation failed)
+				return FIBITMAP.Zero;
+			}
+
+			SerialDib sdib;
+			int read = 0;
+			System.IO.MemoryStream stream = new System.IO.MemoryStream();
+			byte[] buffer = new byte[1024];
+
+			do
+			{
+				// Use the helper function 'Read' to read from the source
+				read = Read(io, handle, 1, 1024, ref buffer);
+
+				// Store the data in a temporary buffer
+				stream.Write(buffer, 0, read);
+			}
+			while (read != 0);
+
+			// Set the memory stream back to the beginning.
+			stream.Position = 0;
+
+			// Unzip the stream
+			GZipStream zipStream = new GZipStream(stream, CompressionMode.Decompress);
+
+			// Create a serializer
+			BinaryFormatter formatter = new BinaryFormatter();
+
+			// Deserialize the stream
+			sdib = (SerialDib)formatter.Deserialize(zipStream);
+
+			// Unload the stream
+			zipStream.Dispose();
+
+			// Use 'ConvertFromRawBits and the deserialized struct to recreate the bitmap
+			// In this case the marshaller is used to create the needed IntPtr to the data
+			// array.
+			FIBITMAP dib = FreeImage.ConvertFromRawBits(
+				Marshal.UnsafeAddrOfPinnedArrayElement(sdib.data, 0),
+				(int)sdib.width, (int)sdib.height, sdib.pitch, sdib.bpp,
+				sdib.red_mask, sdib.green_mask, sdib.blue_mask,
+				false);
+
+			// Unload the temporary stream
+			stream.Dispose();
+
+			// Return the created bitmap
+			return dib;
+		}
+
+		// Saving function
+		protected override bool SaveProc(ref FreeImageIO io, FIBITMAP dib, fi_handle handle, int page, int flags, IntPtr data)
+		{
+			SerialDib sdib;
+			uint size = FreeImage.GetDIBSize(dib);
+
+			// Store all data needed to recreate the bitmap
+			sdib.width = FreeImage.GetWidth(dib);
+			sdib.height = FreeImage.GetHeight(dib);
+			sdib.pitch = (int)FreeImage.GetPitch(dib);
+			sdib.bpp = FreeImage.GetBPP(dib);
+			sdib.red_mask = FreeImage.GetRedMask(dib);
+			sdib.green_mask = FreeImage.GetGreenMask(dib);
+			sdib.blue_mask = FreeImage.GetBlueMask(dib);
+			sdib.data = new byte[size];
+
+			// Copy the bitmaps data into the structures byte-array
+			// The marshaller is used to create an IntPtr for using
+			// 'ConvertToRawBits'.
+			FreeImage.ConvertToRawBits(Marshal.UnsafeAddrOfPinnedArrayElement(sdib.data, 0),
+						  dib, sdib.pitch, sdib.bpp,
+						  sdib.red_mask, sdib.green_mask, sdib.blue_mask,
+						  false);
+
+			// Use the healper function to write the header to the destination
+			if (Write(io, handle, (uint)header.Length, 1, ref header) != 1)
+				return false;
+
+			// Create a serializer
+			BinaryFormatter formatter = new BinaryFormatter();
+
+			// Create a temporary stream
+			MemoryStream stream = new MemoryStream();
+
+			// Create a compression stream
+			GZipStream zipStream = new GZipStream(stream, CompressionMode.Compress);
+
+			// Serialize the structure into the compression stream
+			formatter.Serialize(zipStream, sdib);
+
+			// Unload the compression stream
+			zipStream.Dispose();
+
+			// Get the result data
+			byte[] buffer = stream.GetBuffer();
+
+			// Use the healper function 'Write' to write the data to the destination
+			if (Write(io, handle, 1, (uint)buffer.Length, ref buffer) != buffer.Length)
+			{
+				// Unload the temporary stream
+				stream.Dispose();
+				return false;
+			}
+
+			// Unload the temporary stream
+			stream.Dispose();
+			return true;
+		}
+
+		// Return a list of supported file extensions (comma seperated)
+		protected override string ExtensionListProc()
+		{
+			return "ser";
+		}
+
+		// Implementation of 'ToString()'
+		public override string ToString()
+		{
+			return DescriptionProc();
+		}
+	}
+}